CAS 871112-87-7
:4-Piperidinamine, N-ethyl-N-(phenylmethyl)-, hydrochloride (1:2)
Description:
4-Piperidinamine, N-ethyl-N-(phenylmethyl)-, hydrochloride (1:2), with the CAS number 871112-87-7, is a chemical compound characterized by its piperidine core structure, which is a six-membered ring containing one nitrogen atom. This compound features an ethyl group and a phenylmethyl group attached to the nitrogen atom, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications. The presence of the piperidine ring suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals and can interact with various biological targets. The compound may exhibit properties such as basicity due to the nitrogen atom, and it may participate in hydrogen bonding due to the presence of the amine functional group. Its specific applications and effects would depend on further studies, including pharmacological evaluations and toxicity assessments. Overall, this compound represents a class of organic molecules with potential significance in medicinal chemistry.
Formula:C14H22N2·2ClH
InChI:InChI=1S/C14H22N2.2ClH/c1-2-16(14-8-10-15-11-9-14)12-13-6-4-3-5-7-13;;/h3-7,14-15H,2,8-12H2,1H3;2*1H
InChI key:InChIKey=XJUJSCSNYXLJGB-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CC)C2CCNCC2.Cl
Synonyms:- 4-Piperidinamine, N-ethyl-N-(phenylmethyl)-, hydrochloride (1:2)
- 4-Piperidinamine, N-ethyl-N-(phenylmethyl)-, dihydrochloride
- N-Benzyl-N-ethylpiperidin-4-amine dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
