CymitQuimica logo

CAS 87112-48-9

:

1-{[3-(dimethylamino)propyl](oxido)-lambda~5~-azanyl}-2,2,3,3,4,4-hexafluoro-4-(heptafluoropropoxy)butan-1-one

Description:
The chemical substance known as 1-{[3-(dimethylamino)propyl](oxido)-lambda~5~-azanyl}-2,2,3,3,4,4-hexafluoro-4-(heptafluoropropoxy)butan-1-one, with the CAS number 87112-48-9, is characterized by its complex molecular structure, which includes multiple functional groups and fluorinated components. This compound features a dimethylamino group, which is known for its basicity and potential to participate in various chemical reactions. The presence of hexafluoro and heptafluoropropoxy groups indicates a high degree of fluorination, contributing to unique properties such as low surface tension, high thermal stability, and potential hydrophobic characteristics. The oxido-lambda~5~-azanyl moiety suggests the presence of a nitrogen atom in a specific oxidation state, which may influence the compound's reactivity and interactions with other substances. Overall, this compound is likely to exhibit significant chemical stability and may be of interest in specialized applications, including pharmaceuticals, agrochemicals, or advanced materials, due to its unique fluorinated structure and functional groups.
Formula:C12H13F13N2O3
InChI:InChI=1/C12H13F13N2O3/c1-26(2)4-3-5-27(29)6(28)7(13,14)8(15,16)11(22,23)30-12(24,25)9(17,18)10(19,20)21/h27H,3-5H2,1-2H3
SMILES:CN(C)CCCN(=O)C(=O)C(C(C(F)(F)OC(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:
  • Butanamide, N-(3-(dimethylamino)propyl)-2,2,3,3,4,4-hexafluoro-4-(heptafluoropropoxy)-, N-oxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.