CAS 87112-49-0
:2-Isopropyl-8-methylphenanthrene-3,4-dione
Description:
2-Isopropyl-8-methylphenanthrene-3,4-dione, identified by its CAS number 87112-49-0, is an organic compound belonging to the class of phenanthrene derivatives. This substance features a polycyclic aromatic hydrocarbon structure, characterized by a phenanthrene backbone with two ketone functional groups at the 3 and 4 positions, along with isopropyl and methyl substituents. The presence of these substituents influences its physical and chemical properties, such as solubility, reactivity, and stability. Typically, compounds of this nature exhibit moderate to low solubility in water but may dissolve in organic solvents. They can participate in various chemical reactions, including oxidation and reduction, due to the presence of the carbonyl groups. Additionally, such compounds may have applications in organic synthesis, materials science, or as intermediates in the production of more complex molecules. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with their use.
Formula:C18H16O2
InChI:InChI=1S/C18H16O2/c1-10(2)15-9-12-7-8-13-11(3)5-4-6-14(13)16(12)18(20)17(15)19/h4-10H,1-3H3
InChI key:InChIKey=SLTQYODWMZBDPJ-UHFFFAOYSA-N
SMILES:O=C1C=2C=3C(C=CC2C=C(C(C)C)C1=O)=C(C)C=CC3
Synonyms:- 18,20-Dinor-1,3,5(10),6,8,13-abietahexaene-11,12-dione
- 2-Isopropyl-8-methylphenanthrene-3,4-dione
- 3,4-Phenanthrenedione, 8-methyl-2-(1-methylethyl)-
- 8-Methyl-2-(1-methylethyl)-3,4-phenanthrenedione
- Ro 09-0680
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ro 09-0680
CAS:Ro 09-0680 is a compound derived from Salvia miltiorrhiza, an inhibitor of platelet aggregation used in the study of cardiovascular disease.Formula:C18H16O2Purity:98.25% - 98.37%Color and Shape:SolidMolecular weight:264.32Miltirone I
CAS:<p>Miltirone is a bioactive compound, which is a diterpene quinone found primarily in the roots of Salvia miltiorrhiza, also known as Danshen. Its mode of action involves modulating multiple cellular pathways and targets, including the inhibition of cytochrome P450 enzymes and influencing various signaling cascades, such as the MAPK and NF-κB pathways. This multifaceted interaction allows Miltirone to exert significant anticancer and anti-inflammatory effects.</p>Formula:C18H16O2Purity:Min. 95%Molecular weight:264.32 g/mol


