CAS 871125-96-1

B-[4-[(3-Chlorophenyl)methoxy]phenyl]boronic acid

Description:

B-[4-[(3-Chlorophenyl)methoxy]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound features a phenyl ring substituted with a methoxy group and a chlorophenyl moiety, contributing to its potential reactivity and solubility properties. The presence of the boronic acid group allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the chlorophenyl substituent may influence the compound's electronic properties and biological activity. Overall, B-[4-[(3-Chlorophenyl)methoxy]phenyl]boronic acid is a versatile compound with applications in drug development and materials science, particularly in the design of targeted therapies and in the synthesis of complex organic molecules.

Formula: C₁₃H₁₂BClO₃

InChI: InChI=1S/C13H12BClO3/c15-12-3-1-2-10(8-12)9-18-13-6-4-11(5-7-13)14(16)17/h1-8,16-17H,9H2

InChI key: InChIKey=DFIQBPGCTYISHA-UHFFFAOYSA-N

SMILES: O(CC1=CC(Cl)=CC=C1)C2=CC=C(B(O)O)C=C2

Synonyms:

• [4-[(3-Chlorobenzyl)oxy]phenyl]boronic acid
• Boronic acid, B-[4-[(3-chlorophenyl)methoxy]phenyl]-
• B-[4-[(3-Chlorophenyl)methoxy]phenyl]boronic acid
• [4-[(3-Chlorophenyl)methoxy]phenyl]boronic acid
• Boronic acid, [4-[(3-chlorophenyl)methoxy]phenyl]-

4-(3-Chlorophenylmethoxy)phenylboronic acid

CAS: 871125-96-1

Formula: C₁₃H₁₂BClO₃

Molecular weight: 262.4966

Ref: IN-DA004TYZ