CAS 871126-30-6

(αE)-4-Fluoro-α-(2-furanylmethylene)benzeneacetonitrile

Description:

(αE)-4-Fluoro-α-(2-furanylmethylene)benzeneacetonitrile, with CAS number 871126-30-6, is a chemical compound characterized by its unique structural features, including a fluorine atom and a furan ring. This compound belongs to the class of nitriles and is notable for its potential applications in medicinal chemistry and organic synthesis. The presence of the furan moiety contributes to its reactivity and may influence its biological activity. The fluorine substituent can enhance lipophilicity and metabolic stability, making it an interesting candidate for drug development. The compound's configuration, indicated by the (αE) designation, suggests specific stereochemical properties that may affect its interaction with biological targets. Additionally, its molecular structure allows for various functionalization possibilities, which can be explored in synthetic chemistry. Overall, (αE)-4-Fluoro-α-(2-furanylmethylene)benzeneacetonitrile represents a versatile compound with potential implications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₃H₈FNO

InChI: InChI=1S/C13H8FNO/c14-12-5-3-10(4-6-12)11(9-15)8-13-2-1-7-16-13/h1-8H/b11-8-

InChI key: InChIKey=MUWUPWITGWTNAK-FLIBITNWSA-N

SMILES: C(=C/C1=CC=CO1)(\C#N)/C2=CC=C(F)C=C2

Synonyms:

• Benzeneacetonitrile, 4-fluoro-α-(2-furanylmethylene)-, (αE)-
• (αE)-4-Fluoro-α-(2-furanylmethylene)benzeneacetonitrile