CymitQuimica logo

CAS 871133-25-4

:

Poly(oxy-1,2-ethanediyl), α-(2-carboxyethyl)-ω-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]-

Description:
Poly(oxy-1,2-ethanediyl), α-(2-carboxyethyl)-ω-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]- is a complex polymeric compound characterized by its polyether backbone, which is derived from ethylene oxide. This substance features functional groups that include carboxylic acid and amine functionalities, contributing to its potential as a surfactant or emulsifying agent. The presence of the pyrrole derivative suggests that it may exhibit biological activity, possibly influencing its solubility and interaction with biological systems. Its molecular structure indicates that it can form hydrogen bonds, enhancing its compatibility with various solvents and biological molecules. The polymer's properties, such as molecular weight, viscosity, and thermal stability, can vary significantly based on its synthesis conditions and the ratio of its constituent monomers. Overall, this compound may find applications in pharmaceuticals, biotechnology, and materials science due to its unique chemical characteristics and functional versatility.
Formula:(C2H4O)nC12H16N2O6
Synonyms:
  • Poly(oxy-1,2-ethanediyl), α-(2-carboxyethyl)-ω-[2-[[3-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxopropyl]amino]ethoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.