
CAS 87116-69-6
:2-(1-Methylethyl)-4-propylthiazole
Description:
2-(1-Methylethyl)-4-propylthiazole, identified by its CAS number 87116-69-6, is an organic compound belonging to the thiazole family, characterized by a five-membered ring containing both sulfur and nitrogen atoms. This compound typically exhibits a yellowish to brownish liquid form and possesses a distinctive odor, which may be reminiscent of certain spices or food flavors. Its molecular structure features a thiazole ring substituted with isopropyl and propyl groups, contributing to its unique chemical properties. The presence of these alkyl groups can influence its solubility, volatility, and reactivity. Thiazoles are known for their applications in various fields, including pharmaceuticals, agrochemicals, and as flavoring agents in food products. Additionally, compounds like 2-(1-Methylethyl)-4-propylthiazole may exhibit biological activity, making them of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H15NS
InChI:InChI=1S/C9H15NS/c1-4-5-8-6-11-9(10-8)7(2)3/h6-7H,4-5H2,1-3H3
InChI key:InChIKey=RQVTUZSNNLPWLJ-UHFFFAOYSA-N
SMILES:C(C)(C)C1=NC(CCC)=CS1
Synonyms:- Thiazole, 2-(1-methylethyl)-4-propyl-
- 2-(Propan-2-yl)-4-propyl-1,3-thiazole
- 2-(1-Methylethyl)-4-propylthiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.