CAS 87116-71-0

4-Methyl-2,5-dipropylthiazole

Description:

4-Methyl-2,5-dipropylthiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a methyl group and two propyl groups attached to the thiazole ring, contributing to its unique chemical properties and potential applications. It is typically a colorless to pale yellow liquid with a distinctive odor, often associated with certain food flavors and fragrances. The presence of the thiazole moiety suggests that it may exhibit biological activity, making it of interest in fields such as flavor chemistry and pharmaceuticals. Its molecular structure allows for various interactions, including hydrogen bonding and hydrophobic interactions, which can influence its solubility and reactivity. As with many thiazole derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₇NS

InChI: InChI=1S/C10H17NS/c1-4-6-9-8(3)11-10(12-9)7-5-2/h4-7H2,1-3H3

InChI key: InChIKey=VAEQRSTWJQPJLA-UHFFFAOYSA-N

SMILES: C(CC)C1=C(C)N=C(CCC)S1

Synonyms:

• 2,5-Dipropyl-4-methylthiazole
• 4-Methyl-2,5-dipropylthiazole
• Thiazole, 4-methyl-2,5-dipropyl-