CAS 87118-95-4

3,4,5,6,6-Pentamethyl-2-heptanol

Description:

3,4,5,6,6-Pentamethyl-2-heptanol is an organic compound characterized by its complex structure, which includes a heptanol backbone with multiple methyl substituents. This compound features a hydroxyl (-OH) functional group, making it an alcohol. The presence of five methyl groups at the 3, 4, 5, and 6 positions contributes to its branched structure, which can influence its physical properties, such as boiling point and solubility. Typically, branched alcohols like this one exhibit lower boiling points compared to their straight-chain counterparts due to reduced surface area and weaker van der Waals forces. The compound is likely to be less polar than simpler alcohols, affecting its solubility in water and organic solvents. Additionally, the presence of multiple methyl groups can enhance its hydrophobic character. 3,4,5,6,6-Pentamethyl-2-heptanol may find applications in various fields, including organic synthesis and as a potential intermediate in the production of other chemical compounds. However, specific applications and safety data should be consulted from reliable sources for practical use.

Formula: C₁₂H₂₆O

InChI: InChI=1/C12H26O/c1-8(9(2)11(4)13)10(3)12(5,6)7/h8-11,13H,1-7H3

InChI key: InChIKey=XEFKRPWKRQTXDA-UHFFFAOYSA-N

SMILES: C(C(C(C)(C)C)C)(C(C(C)O)C)C

Synonyms:

• 2-Heptanol, 3,4,5,6,6-Pentamethyl-
• 3,4,5,6,6-Pentamethyl-2-heptanol
• Koavol DH
• Qy1& Y1& Y1& Y1& X1& 1& 1
• 3,4,5,6,6-Pentamethylheptan-2-ol
• amber carbinol

3,4,5,6,6-Pentamethyl-2-heptanol

Controlled Product

CAS: 87118-95-4

Formula: C₁₂H₂₆O

Color and Shape: Neat

Molecular weight: 186.334

Ref: TR-P272000