CAS 87119-13-9

1,2,5-Thiadiazol-3-amine, 4-methoxy-, 1-oxide

Description:

1,2,5-Thiadiazol-3-amine, 4-methoxy-, 1-oxide, with the CAS number 87119-13-9, is a heterocyclic organic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features an amine functional group and a methoxy substituent, contributing to its chemical reactivity and potential applications. The 1-oxide designation indicates the presence of an oxygen atom bonded to the nitrogen in the thiadiazole ring, which can influence its electronic properties and stability. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The presence of the methoxy group can enhance solubility and modify the compound's interaction with biological targets. Overall, the unique structural features of 1,2,5-Thiadiazol-3-amine, 4-methoxy-, 1-oxide suggest potential utility in various chemical and medicinal applications, although specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₃H₅N₃O₂S

InChI: InChI=1S/C3H5N3O2S/c1-8-3-2(4)5-9(7)6-3/h1H3,(H2,4,5)

InChI key: InChIKey=OHLUAARMJNNWIK-UHFFFAOYSA-N

SMILES: O(C)C=1C(N)=NS(=O)N1

Synonyms:

• 3-Amino-4-methoxy-1λ4,2,5-thiadiazol-1-one
• 1,2,5-Thiadiazol-3-amine, 4-methoxy-, 1-oxide