CAS 871217-36-6

4-[[4-(5-Methyl-2-thienyl)-2-thiazolyl]amino]butanoic acid

Description:

4-[[4-(5-Methyl-2-thienyl)-2-thiazolyl]amino]butanoic acid, identified by its CAS number 871217-36-6, is a synthetic organic compound characterized by its unique structural features, including a thiazole ring and a thienyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The thiazole and thienyl moieties contribute to its biological activity, making it of interest in pharmaceutical research, particularly in the development of compounds with potential therapeutic applications. Its molecular structure suggests it may engage in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the presence of the methyl group on the thienyl ring may enhance lipophilicity, affecting its pharmacokinetic properties. Overall, this compound represents a class of molecules that may exhibit significant biological activity, warranting further investigation in medicinal chemistry.

Formula: C₁₂H₁₄N₂O₂S₂

InChI: InChI=1S/C12H14N2O2S2/c1-8-4-5-10(18-8)9-7-17-12(14-9)13-6-2-3-11(15)16/h4-5,7H,2-3,6H2,1H3,(H,13,14)(H,15,16)

InChI key: InChIKey=GYUXYYGGNQVDLU-UHFFFAOYSA-N

SMILES: N(CCCC(O)=O)C1=NC(=CS1)C2=CC=C(C)S2

Synonyms:

• 4-[[4-(5-Methyl-2-thienyl)-2-thiazolyl]amino]butanoic acid
• Butanoic acid, 4-[[4-(5-methyl-2-thienyl)-2-thiazolyl]amino]-

4-{[4-(5-Methylthiophen-2-yl)-1,3-thiazol-2-yl]amino}butanoic acid

Controlled Product

CAS: 871217-36-6

4-{[4-(5-Methylthiophen-2-yl)-1,3-thiazol-2-yl]amino}butanoic acid is a chemical compound with pharmacological activity. It has been shown to have an affinity for the GABA receptor.

Formula: C₁₂H₁₄N₂O₂S₂

Purity: Min. 95%

Molecular weight: 282.4 g/mol

Ref: 3D-WJB21736