
CAS 871217-39-9
:7-(2-Furanylmethyl)-3,7-dihydro-3-(phenylmethyl)-1H-purine-2,6-dione
Description:
7-(2-Furanylmethyl)-3,7-dihydro-3-(phenylmethyl)-1H-purine-2,6-dione, with the CAS number 871217-39-9, is a synthetic compound that belongs to the purine class of molecules. This substance features a purine core, which is characterized by a fused double-ring structure containing nitrogen atoms. The presence of a furan ring and a phenylmethyl group contributes to its unique chemical properties and potential biological activities. Typically, compounds of this nature may exhibit various pharmacological effects, including anti-inflammatory or anti-cancer properties, due to their ability to interact with biological targets such as enzymes or receptors. The compound's solubility, stability, and reactivity can vary based on its functional groups and molecular structure. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. As with many synthetic organic compounds, understanding its safety profile and potential applications in medicinal chemistry would be essential for further development and research.
Formula:C17H14N4O3
InChI:InChI=1S/C17H14N4O3/c22-16-14-15(18-11-20(14)10-13-7-4-8-24-13)21(17(23)19-16)9-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,19,22,23)
InChI key:InChIKey=BRWQTMFMKDSIKP-UHFFFAOYSA-N
SMILES:C(N1C2=C(N(CC3=CC=CO3)C=N2)C(=O)NC1=O)C4=CC=CC=C4
Synonyms:- 1H-Purine-2,6-dione, 7-(2-furanylmethyl)-3,7-dihydro-3-(phenylmethyl)-
- 7-(2-Furanylmethyl)-3,7-dihydro-3-(phenylmethyl)-1H-purine-2,6-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.