
CAS 871217-44-6
:N-Methyl-2-(4-morpholinyl)benzenemethanamine
Description:
N-Methyl-2-(4-morpholinyl)benzenemethanamine, identified by its CAS number 871217-44-6, is a chemical compound that features a benzene ring substituted with a morpholine group and a methylamine moiety. This compound is characterized by its amine functional group, which contributes to its basicity and potential reactivity in various chemical reactions. The presence of the morpholine ring, a six-membered heterocyclic structure containing both oxygen and nitrogen, imparts unique properties such as increased solubility in polar solvents and potential interactions with biological systems. N-Methyl-2-(4-morpholinyl)benzenemethanamine may exhibit pharmacological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of more complex organic molecules or as a building block in pharmaceutical formulations. Safety and handling precautions should be observed, as with any chemical substance, due to the potential for toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C12H18N2O
InChI:InChI=1S/C12H18N2O/c1-13-10-11-4-2-3-5-12(11)14-6-8-15-9-7-14/h2-5,13H,6-10H2,1H3
InChI key:InChIKey=HUJGEEUTLCYING-UHFFFAOYSA-N
SMILES:C(NC)C1=C(C=CC=C1)N2CCOCC2
Synonyms:- N-Methyl-2-(4-morpholinyl)benzenemethanamine
- Benzenemethanamine, N-methyl-2-(4-morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.