CAS 871217-50-4

2-Chloro-1-(octahydro-2(1H)-isoquinolinyl)ethanone

Description:

2-Chloro-1-(octahydro-2(1H)-isoquinolinyl)ethanone is a chemical compound characterized by its unique structure, which includes a chloro group and an octahydro-isoquinoline moiety. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the chloro substituent enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The octahydro-2(1H)-isoquinoline structure indicates that it is a bicyclic compound, which may exhibit interesting biological activities due to its complex ring system. Compounds of this nature are often investigated for their potential pharmacological properties, including analgesic or anti-inflammatory effects. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the chloro group and the overall molecular structure. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of halogenated groups, which can pose environmental and health risks.

Formula: C₁₁H₁₈ClNO

InChI: InChI=1S/C11H18ClNO/c12-7-11(14)13-6-5-9-3-1-2-4-10(9)8-13/h9-10H,1-8H2

InChI key: InChIKey=DNDCGDMWWJNDNP-UHFFFAOYSA-N

SMILES: C(CCl)(=O)N1CC2C(CC1)CCCC2

Synonyms:

• Isoquinoline, 2-(chloroacetyl)decahydro-
• 2-Chloro-1-(decahydroisoquinolin-2-yl)ethan-1-one
• 2-Chloro-1-(octahydro-2(1H)-isoquinolinyl)ethanone
• Ethanone, 2-chloro-1-(octahydro-2(1H)-isoquinolinyl)-