CAS 871217-90-2
:4-[(2-Chloroacetyl)amino]-N-methylbenzamide
Description:
4-[(2-Chloroacetyl)amino]-N-methylbenzamide, with the CAS number 871217-90-2, is a chemical compound characterized by its amide functional group and the presence of a chloroacetyl substituent. This compound features a benzamide structure, where a methyl group is attached to the nitrogen atom of the amide, enhancing its lipophilicity. The chloroacetyl group introduces a reactive site, making the compound potentially useful in various chemical reactions, including acylation and nucleophilic substitution. Its molecular structure suggests it may exhibit biological activity, possibly as a pharmaceutical intermediate or in medicinal chemistry applications. The presence of chlorine can influence its reactivity and solubility in organic solvents. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the environment in which it is studied. Overall, 4-[(2-Chloroacetyl)amino]-N-methylbenzamide is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H11ClN2O2
InChI:InChI=1S/C10H11ClN2O2/c1-12-10(15)7-2-4-8(5-3-7)13-9(14)6-11/h2-5H,6H2,1H3,(H,12,15)(H,13,14)
InChI key:InChIKey=VDASREDBSSNOSU-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1=CC=C(C(NC)=O)C=C1
Synonyms:- Benzamide, 4-[(2-chloroacetyl)amino]-N-methyl-
- 4-[(2-Chloroacetyl)amino]-N-methylbenzamide
- Benzamide, 4-[(chloroacetyl)amino]-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.