CAS 871217-92-4
:N-(3-Methoxypropyl)-1-piperazineacetamide
Description:
N-(3-Methoxypropyl)-1-piperazineacetamide is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic amine containing two nitrogen atoms. This compound features a methoxypropyl group, which contributes to its hydrophobic properties, enhancing its solubility in organic solvents. The presence of the acetamide functional group indicates that it can participate in hydrogen bonding, potentially influencing its biological activity and interaction with various receptors. Typically, compounds like this may exhibit pharmacological properties, making them of interest in medicinal chemistry and drug development. The molecular structure suggests potential applications in areas such as neuropharmacology or as a scaffold for synthesizing more complex molecules. Its specific characteristics, including melting point, boiling point, and reactivity, would depend on its molecular interactions and the environment in which it is studied. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its toxicity and environmental impact.
Formula:C10H21N3O2
InChI:InChI=1S/C10H21N3O2/c1-15-8-2-3-12-10(14)9-13-6-4-11-5-7-13/h11H,2-9H2,1H3,(H,12,14)
InChI key:InChIKey=NYDJHEJJJKWIMQ-UHFFFAOYSA-N
SMILES:C(C(NCCCOC)=O)N1CCNCC1
Synonyms:- 1-Piperazineacetamide, N-(3-methoxypropyl)-
- N-(3-Methoxypropyl)-1-piperazineacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
