CAS 871224-00-9

Benzoic acid, 3-ethenyl-2,4-difluoro-

Description:

Benzoic acid, 3-ethenyl-2,4-difluoro- is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety with additional functional groups. The presence of the ethenyl group indicates that it has a vinyl substituent, contributing to its reactivity and potential applications in organic synthesis. The difluoro substituents at the 2 and 4 positions of the aromatic ring enhance its chemical properties, such as increased acidity and altered electronic characteristics, which can influence its behavior in various chemical reactions. This compound may exhibit unique solubility properties due to the combination of polar and nonpolar characteristics from the carboxylic acid and the aromatic ring. Additionally, the presence of fluorine atoms can impart distinctive properties, such as increased stability and altered lipophilicity, making it of interest in pharmaceuticals and materials science. Overall, benzoic acid, 3-ethenyl-2,4-difluoro- is a versatile compound with potential applications in various fields, including medicinal chemistry and polymer science.

Formula: C₉H₆F₂O₂

InChI: InChI=1S/C9H6F2O2/c1-2-5-7(10)4-3-6(8(5)11)9(12)13/h2-4H,1H2,(H,12,13)

InChI key: InChIKey=HRRIWMPGJOWSAW-UHFFFAOYSA-N

SMILES: C(=C)C1=C(F)C(C(O)=O)=CC=C1F

Synonyms:

• 2,4-Difluoro-3-vinylbenzoic acid
• 3-Ethenyl-2,4-difluorobenzoic acid
• Benzoic acid, 3-ethenyl-2,4-difluoro-