CAS 871224-67-8

Methyl 6-(trifluoromethyl)-3-pyridinepropanoate

Description:

Methyl 6-(trifluoromethyl)-3-pyridinepropanoate, identified by its CAS number 871224-67-8, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a trifluoromethyl group (-CF3) at the 6-position of the pyridine, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the methyl ester functional group (-COOCH3) at the 3-position contributes to its reactivity and solubility in organic solvents. Methyl 6-(trifluoromethyl)-3-pyridinepropanoate is typically used in synthetic organic chemistry and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its trifluoromethyl group can enhance the compound's metabolic stability and alter its interaction with biological targets. As with many fluorinated compounds, it may exhibit unique properties such as increased resistance to degradation, making it of interest in various chemical applications. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds.

Formula: C₁₀H₁₀F₃NO₂

InChI: InChI=1S/C10H10F3NO2/c1-16-9(15)5-3-7-2-4-8(14-6-7)10(11,12)13/h2,4,6H,3,5H2,1H3

InChI key: InChIKey=CIGAGKCAOUZZCH-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=CC=C(CCC(OC)=O)C=N1

Synonyms:

• Methyl 6-(trifluoromethyl)-3-pyridinepropanoate
• 3-Pyridinepropanoic acid, 6-(trifluoromethyl)-, methyl ester