CAS 871231-42-4

Borate(1-), (2,6-dimethoxyphenyl)trifluoro-, potassium (1:1), (T-4)-

Description:

Borate(1-), (2,6-dimethoxyphenyl)trifluoro-, potassium (1:1), commonly referred to by its CAS number 871231-42-4, is a chemical compound that features a borate anion complexed with a potassium cation. This compound is characterized by the presence of a trifluoromethyl group and a dimethoxyphenyl moiety, which contribute to its unique chemical properties and reactivity. The trifluoromethyl group is known for enhancing the lipophilicity and stability of organic compounds, while the dimethoxyphenyl group can influence the compound's electronic properties and potential interactions in various chemical environments. As a borate, it may exhibit properties typical of boron compounds, such as acting as a Lewis acid or participating in coordination chemistry. The potassium ion serves to balance the charge of the borate anion, making the compound stable in various solvents. Overall, this compound may find applications in organic synthesis, materials science, or as a reagent in chemical reactions, although specific applications would depend on further research and exploration of its properties.

Formula: C₈H₉BF₃O₂·K

InChI: InChI=1S/C8H9BF3O2.K/c1-13-6-4-3-5-7(14-2)8(6)9(10,11)12;/h3-5H,1-2H3;/q-1;+1

InChI key: InChIKey=RFOWQNHYQDZXLK-UHFFFAOYSA-N

SMILES: [B+3]([F-])([F-])([F-])[C-]=1C(OC)=CC=CC1OC.[K+]

Synonyms:

• Borate(1-), (2,6-dimethoxyphenyl)trifluoro-, potassium (1:1), (T-4)-
• Borate(1-), (2,6-dimethoxyphenyl)trifluoro-, potassium, (T-4)-
• Potassium trifluoro(2,6-dimethoxyphenyl)borate
• Potassium (2,6-dimethoxyphenyl)trifluoroborate