CAS 871231-43-5

potassium trifluoro[4-(methylsulfanyl)phenyl]borate(1-)

Description:

Potassium trifluoro[4-(methylsulfanyl)phenyl]borate(1-) is an organoboron compound characterized by the presence of a boron atom bonded to a trifluoromethyl group and a phenyl ring that is substituted with a methylthio group. This compound typically exhibits properties associated with both boron and fluorine, such as high reactivity and potential applications in organic synthesis and catalysis. The trifluoroborate moiety enhances its solubility in polar solvents, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methylsulfanyl group contributes to its unique reactivity profile, allowing for specific interactions in organic transformations. Additionally, the potassium cation provides stability and solubility in aqueous environments. Overall, this compound is of interest in the field of synthetic organic chemistry, particularly in the development of new methodologies for the construction of complex molecules.

Formula: C₇H₇BF₃KS

InChI: InChI=1/C7H7BF3S.K/c1-12-7-4-2-6(3-5-7)8(9,10)11;/h2-5H,1H3;/q-1;+1

SMILES: CSc1ccc(cc1)[B-](F)(F)F.K

Potassium 4-(methylthio)phenyltrifluoroborate

CAS: 871231-43-5

Formula: C₇H₇BF₃KS

Purity: 95%

Color and Shape: Solid

Molecular weight: 230.1000

Ref: IN-DA00GUOX

Potassium trifluoro(4-(methylthio)phenyl)borate

CAS: 871231-43-5

Potassium trifluoro(4-(methylthio)phenyl)borate

Purity: 95%

Ref: 54-PC1001399

potassium trifluoro[4-(methylsulfanyl)phenyl]boranuide

CAS: 871231-43-5

Purity: 95%

Molecular weight: 230.1000061

Ref: 10-F863779