CAS 871266-86-3

7-chloro-N-(propan-2-yl)[1,3]thiazolo[5,4-d]pyrimidin-2-amine

Description:

7-Chloro-N-(propan-2-yl)[1,3]thiazolo[5,4-d]pyrimidin-2-amine is a chemical compound characterized by its unique structural features, which include a thiazole and pyrimidine ring system. The presence of a chlorine atom at the 7-position and an isopropyl group at the nitrogen atom contributes to its potential biological activity. This compound is typically classified as a heterocyclic amine, which may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery. The thiazolo and pyrimidinyl moieties may enhance its pharmacological profile, possibly influencing solubility, stability, and bioavailability. Additionally, the compound's CAS number, 871266-86-3, allows for easy identification and retrieval of information in chemical databases. Overall, the characteristics of this compound position it as a candidate for further research in various applications, including therapeutic development and chemical synthesis.

Formula: C₈H₉ClN₄S

InChI: InChI=1/C8H9ClN4S/c1-4(2)12-8-13-5-6(9)10-3-11-7(5)14-8/h3-4H,1-2H3,(H,12,13)

SMILES: CC(C)N=c1[nH]c2c(Cl)ncnc2s1

Synonyms:

• (7-Chlorothiazolo[5,4-d]pyrimidin-2-yl)isopropylamine
• 871266-86-3

7-Chloro-n-isopropylthiazolo[5,4-d]pyrimidin-2-amine

CAS: 871266-86-3

7-Chloro-n-isopropylthiazolo[5,4-d]pyrimidin-2-amine

Purity: ≥95%

Molecular weight: 228.70g/mol

Ref: 54-OR322907