CAS 871269-04-4
:5′-Bromo-2′,6-diethoxy-3,4′-bipyridine
Description:
5′-Bromo-2′,6-diethoxy-3,4′-bipyridine is a chemical compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. The presence of bromine at the 5′ position and ethoxy groups at the 2′ and 6′ positions significantly influences its chemical properties and reactivity. This compound is typically used in organic synthesis and may serve as a ligand in coordination chemistry due to the nitrogen atoms in the pyridine rings, which can coordinate with metal ions. The ethoxy groups enhance its solubility in organic solvents, making it suitable for various applications in medicinal chemistry and materials science. Additionally, the bromine substituent can participate in further chemical reactions, such as nucleophilic substitutions. Overall, 5′-Bromo-2′,6-diethoxy-3,4′-bipyridine is a versatile compound with potential applications in research and industry, particularly in the development of new materials and pharmaceuticals.
Formula:C14H15BrN2O2
InChI:InChI=1S/C14H15BrN2O2/c1-3-18-13-6-5-10(8-16-13)11-7-14(19-4-2)17-9-12(11)15/h5-9H,3-4H2,1-2H3
InChI key:InChIKey=BVBDAPBJYPUDBA-UHFFFAOYSA-N
SMILES:BrC1=C(C=C(OCC)N=C1)C=2C=CC(OCC)=NC2
Synonyms:- 3,4′-Bipyridine, 5′-bromo-2′,6-diethoxy-
- 5-Bromo-2,2’-Diethoxy-4,5’-Bipyridine
- 5′-Bromo-2′,6-diethoxy-3,4′-bipyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
