CAS 87129-32-6
:Butyl (R)-(+)-2-(4-hydroxyphenoxy)propionate
Description:
Butyl (R)-(+)-2-(4-hydroxyphenoxy)propionate, with the CAS number 87129-32-6, is an organic compound characterized by its ester functional group. It is derived from the reaction of butanol and a chiral phenolic compound, specifically 4-hydroxyphenoxypropionic acid. This substance typically appears as a colorless to pale yellow liquid and is known for its moderate solubility in organic solvents, while being less soluble in water. The presence of the hydroxyphenyl group contributes to its potential applications in various fields, including pharmaceuticals and cosmetics, due to its antioxidant properties. Additionally, the chiral nature of the compound suggests that it may exhibit specific biological activities, making it of interest in medicinal chemistry. Its stability under standard conditions and relatively low volatility make it suitable for formulation in various products. However, as with any chemical substance, safety data sheets should be consulted for handling and potential hazards associated with its use.
Formula:C13H18O4
InChI:InChI=1S/C13H18O4/c1-3-4-9-16-13(15)10(2)17-12-7-5-11(14)6-8-12/h5-8,10,14H,3-4,9H2,1-2H3
SMILES:CCCCOC(=O)C(C)Oc1ccc(cc1)O
Synonyms:- Butyl (R)-(+)-2-(4-hydroxyphenoxy)propanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

