CAS 871329-51-0
:3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
Description:
3-Nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is an organic compound characterized by the presence of both a nitro group and a boron-containing moiety. The compound features an aniline structure, which consists of an amino group attached to a benzene ring, and a nitro group (-NO2) at the para position relative to the amino group. The boron component, specifically a dioxaborolane, contributes to the compound's potential reactivity and utility in various chemical applications, particularly in organic synthesis and materials science. The presence of the tetramethyl substituents enhances the steric bulk around the boron atom, which can influence the compound's solubility and reactivity. This compound may be of interest in the development of pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its unique functional groups. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases.
Formula:C12H17BN2O4
InChI:InChI=1/C12H17BN2O4/c1-11(2)12(3,4)19-13(18-11)8-5-9(14)7-10(6-8)15(16)17/h5-7H,14H2,1-4H3
SMILES:CC1(C)C(C)(C)OB(c2cc(cc(c2)N(=O)=O)N)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-5-nitrophenylboronic acid, pinacol ester
CAS:Formula:C12H17BN2O4Purity:97%Color and Shape:SolidMolecular weight:264.08543-Amino-5-nitrobenzeneboronic acid, pinacol ester
CAS:3-Amino-5-nitrobenzeneboronic acid, pinacol esterPurity:97%Molecular weight:264.09g/mol3-Amino-5-nitrobenzeneboronic acid pinacol ester
CAS:Formula:C12H17BN2O4Purity:97%Molecular weight:264.093-Amino-5-nitrophenylboronic acid pinacol ester
CAS:<p>3-Amino-5-nitrophenylboronic acid pinacol ester is a versatile building block that can be used in the synthesis of complex compounds. This compound has been shown to have useful properties in research chemicals and as reagents or speciality chemicals. Useful intermediates are usually synthesized from 3-Amino-5-nitrophenylboronic acid pinacol ester, which is also a useful scaffold for the synthesis of other compounds.</p>Formula:C12H17BN2O4Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:264.09 g/mol



