CAS 871329-53-2

[5-(methoxycarbonyl)pyridin-3-yl]boronic acid

Description:

[5-(Methoxycarbonyl)pyridin-3-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has a methoxycarbonyl substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents like methanol and dimethyl sulfoxide, and showing moderate stability under standard conditions. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The methoxycarbonyl group enhances the compound's reactivity and solubility, facilitating its use in coupling reactions and as a building block in the synthesis of more complex molecules. Additionally, the presence of the pyridine ring contributes to the compound's electronic properties, influencing its reactivity and interactions in chemical reactions. Overall, [5-(methoxycarbonyl)pyridin-3-yl]boronic acid is a versatile compound with significant utility in synthetic organic chemistry.

Formula: C₇H₈BNO₄

InChI: InChI=1/C7H8BNO4/c1-13-7(10)5-2-6(8(11)12)4-9-3-5/h2-4,11-12H,1H3

SMILES: COC(=O)c1cc(cnc1)B(O)O

Synonyms:

• 3-Pyridinecarboxylic Acid, 5-Borono-, Methyl Ester
• [5-(METHOXYCARBONYL)PYRIDIN-3-YL]BORONIC ACID

(5-(Methoxycarbonyl)pyridin-3-yl)boronic acid

CAS: 871329-53-2

Formula: C₇H₈BNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 180.9537

Ref: IN-DA004OTD

5-(Methoxycarbonyl)pyridine-3-boronic acid

CAS: 871329-53-2

5-(Methoxycarbonyl)pyridine-3-boronic acid

Formula: C₇H₈BNO₄

Purity: 97%

Color and Shape: white to off-white solid

Molecular weight: 180.95g/mol

Ref: 54-OR5718

(5-(Methoxycarbonyl)pyridin-3-yl)boronic acid

CAS: 871329-53-2

Formula: C₇H₈BNO₄

Purity: 95%

Molecular weight: 180.95

Ref: 10-F327489