CAS 871329-56-5

B-[2-(Ethoxymethyl)phenyl]boronic acid

Description:

B-[2-(Ethoxymethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with an ethoxymethyl group. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The ethoxymethyl substituent enhances its solubility in organic solvents and may influence its reactivity and selectivity in chemical reactions. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The compound's structure suggests potential applications in drug development and materials science, particularly in the design of sensors or catalysts. As with many boronic acids, it may also exhibit pH-dependent behavior, affecting its reactivity and stability in different environments. Overall, B-[2-(Ethoxymethyl)phenyl]boronic acid is a versatile compound with significant implications in synthetic chemistry.

Formula: C₉H₁₃BO₃

InChI: InChI=1S/C9H13BO3/c1-2-13-7-8-5-3-4-6-9(8)10(11)12/h3-6,11-12H,2,7H2,1H3

InChI key: InChIKey=SVBVDEHEAYWGFP-UHFFFAOYSA-N

SMILES: C(OCC)C1=C(B(O)O)C=CC=C1

Synonyms:

• Boronic acid, B-[2-(ethoxymethyl)phenyl]-
• [2-(Ethoxymethyl)phenyl]boronic acid
• Boronic acid, [2-(ethoxymethyl)phenyl]-
• B-[2-(Ethoxymethyl)phenyl]boronic acid

2-Ethoxymethylphenylboronic acid

CAS: 871329-56-5

Formula: C₉H₁₃BO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 180.0087

Ref: IN-DA004KMF

2-Ethoxymethylphenylboronic acid

CAS: 871329-56-5

2-Ethoxymethylphenylboronic acid

Purity: ≥95%

Molecular weight: 180.01g/mol

Ref: 54-OR361200

(2-(Ethoxymethyl)phenyl)boronic acid

CAS: 871329-56-5

Formula: C₉H₁₃BO₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 180.01

Ref: 10-F338227