CAS 871329-66-7

B-[4-[(Cyclohexylamino)sulfonyl]phenyl]boronic acid

Description:

B-[4-[(Cyclohexylamino)sulfonyl]phenyl]boronic acid, with the CAS number 871329-66-7, is a boronic acid derivative characterized by its boron atom bonded to a phenyl group and a sulfonamide moiety. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and organic solvents. It is known for its role in medicinal chemistry, particularly in the development of proteasome inhibitors and as a potential therapeutic agent in cancer treatment. The presence of the cyclohexylamino group enhances its biological activity and solubility profile. Additionally, boronic acids are known for their ability to form reversible covalent bonds with diols, making them useful in various applications, including drug delivery systems and sensor technologies. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.

Formula: C₁₂H₁₈BNO₄S

InChI: InChI=1S/C12H18BNO4S/c15-13(16)10-6-8-12(9-7-10)19(17,18)14-11-4-2-1-3-5-11/h6-9,11,14-16H,1-5H2

InChI key: InChIKey=XYWYVMPPDKSUFJ-UHFFFAOYSA-N

SMILES: S(NC1CCCCC1)(=O)(=O)C2=CC=C(B(O)O)C=C2

Synonyms:

• Boronic acid, [4-[(cyclohexylamino)sulfonyl]phenyl]-
• [4-(N-Cyclohexylsulfamoyl)phenyl]boronic acid
• Boronic acid, B-[4-[(cyclohexylamino)sulfonyl]phenyl]-
• B-[4-[(Cyclohexylamino)sulfonyl]phenyl]boronic acid

N-Cyclohexyl 4-boronobenzenesulfonamide

CAS: 871329-66-7

Formula: C₁₂H₁₈BNO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 283.1516

Ref: IN-DA008FBK

4-(N-Cyclohexylsulphonamido)benzeneboronic acid

CAS: 871329-66-7

4-(N-Cyclohexylsulphonamido)benzeneboronic acid

Purity: 95%

Molecular weight: 283.15g/mol

Ref: 54-OR4131

(4-(N-Cyclohexylsulfamoyl)phenyl)boronic acid

CAS: 871329-66-7

Purity: 95%

Molecular weight: 283.1499939

Ref: 10-F609812