CymitQuimica logo

CAS 871329-78-1

:

B-[3-[(Butylamino)sulfonyl]phenyl]boronic acid

Description:
B-[3-[(Butylamino)sulfonyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical applications, including drug development and materials science. The compound features a phenyl ring substituted with a butylamino group and a sulfonyl moiety, contributing to its solubility and reactivity. Its boronic acid functionality allows it to participate in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the synthesis of complex organic molecules. Additionally, the presence of the butylamino group may enhance its biological activity and solubility in organic solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of inhibitors targeting specific enzymes or receptors. Overall, B-[3-[(Butylamino)sulfonyl]phenyl]boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C10H16BNO4S
InChI:InChI=1S/C10H16BNO4S/c1-2-3-7-12-17(15,16)10-6-4-5-9(8-10)11(13)14/h4-6,8,12-14H,2-3,7H2,1H3
InChI key:InChIKey=LDUILYZFVFIMFG-UHFFFAOYSA-N
SMILES:S(NCCCC)(=O)(=O)C1=CC(B(O)O)=CC=C1
Synonyms:
  • (3-(N-Butylsulfamoyl)phenyl)boronic acid
  • B-[3-[(Butylamino)sulfonyl]phenyl]boronic acid
  • Boronic acid, [3-[(butylamino)sulfonyl]phenyl]-
  • Boronicacid, [3-[(butylamino)sulfonyl]phenyl]- (9CI)
  • Boronic acid, B-[3-[(butylamino)sulfonyl]phenyl]-
Found 4 products.