CymitQuimica logo

CAS 871329-82-7

:

B-(3-Fluoro-5-hydroxyphenyl)boronic acid

Description:
B-(3-Fluoro-5-hydroxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has both a fluorine atom and a hydroxyl group in its structure. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and having moderate stability under standard conditions. The presence of the boronic acid moiety allows it to participate in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The fluorine atom can influence the electronic properties of the molecule, potentially enhancing its reactivity or selectivity in certain reactions. Additionally, the hydroxyl group can engage in hydrogen bonding, affecting the compound's solubility and interaction with biological systems. Overall, B-(3-Fluoro-5-hydroxyphenyl)boronic acid is a versatile compound with applications in drug development and materials science.
Formula:C6H6BFO3
InChI:InChI=1S/C6H6BFO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9-11H
InChI key:InChIKey=RMBFBZIEXCTPDB-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(F)=CC(O)=C1
Synonyms:
  • (3-Fluoro-5-hydroxyphenyl)boronic acid
  • 3-Fluoro-5-Hydroxybenzeneboronic Acid
  • 3-Fluoro-5-hydroxyphenylboronic acid
  • B-(3-Fluoro-5-hydroxyphenyl)boronic acid
  • Boronic acid, (3-fluoro-5-hydroxyphenyl)-
  • boronic acid, B-(3-fluoro-5-hydroxyphenyl)-
Found 5 products.