CAS 871332-67-1

(3-carbamoyl-4-chloro-phenyl)boronic acid

Description:

(3-Carbamoyl-4-chloro-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a chloro substituent and a carbamoyl group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and having moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and medicinal chemistry. The presence of the chloro group can influence its reactivity and solubility, while the carbamoyl group may enhance its biological activity. Additionally, this compound may exhibit properties such as acidity due to the boronic acid group, which can form complexes with diols and other Lewis bases. Overall, (3-carbamoyl-4-chloro-phenyl)boronic acid is a versatile compound with applications in drug development and materials science.

Formula: C₇H₇BClNO₃

InChI: InChI=1/C7H7BClNO3/c9-6-2-1-4(8(12)13)3-5(6)7(10)11/h1-3,12-13H,(H2,10,11)

SMILES: c1cc(c(cc1B(O)O)C(=N)O)Cl

Synonyms:

• (3-Carbamoyl-4-Chlorophenyl)Boronic Acid
• boronic acid, B-[3-(aminocarbonyl)-4-chlorophenyl]-

2-CHLORO-5-BORONOBENZAMIDE

CAS: 871332-67-1

Formula: C₇H₇BClNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 199.3994

Ref: IN-DA004OT4

2-Chloro-5-boronobenzamide

CAS: 871332-67-1

2-Chloro-5-boronobenzamide

Purity: ≥95%

Molecular weight: 199.40g/mol

Ref: 54-OR360288

(3-Carbamoyl-4-chlorophenyl)boronic acid

CAS: 871332-67-1

Formula: C₇H₇BClNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.4

Ref: 10-F219676