CymitQuimica logo

CAS 871333-06-1

:

[3-(4,5-dihydrothiazol-2-ylcarbamoyl)phenyl]boronic acid

Description:
[3-(4,5-dihydrothiazol-2-ylcarbamoyl)phenyl]boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and a thiazole-containing substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The thiazole moiety contributes to its biological activity, potentially influencing interactions with biological targets. The compound is likely to be a solid at room temperature and may exhibit moderate solubility in polar solvents. Its reactivity can be attributed to the boronic acid functional group, which can participate in cross-coupling reactions, a key feature in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the carbamoyl group may enhance its stability and solubility, further broadening its applicability in chemical research and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential hazards associated with boron compounds.
Formula:C10H11BN2O3S
InChI:InChI=1/C10H11BN2O3S/c14-9(13-10-12-4-5-17-10)7-2-1-3-8(6-7)11(15)16/h1-3,6,15-16H,4-5H2,(H,12,13,14)
InChI key:JKXDTFJXMNWUFU-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)B(O)O)C(=NC1=NCCS1)O
Found 4 products.