CymitQuimica logo

CAS 871333-97-0

:

2-(4,4-dimethylcyclohexa-1,5-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-(4,4-Dimethylcyclohexa-1,5-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a substituted cyclohexadiene moiety. The presence of the dioxaborolane functional group suggests potential applications in organic synthesis, particularly in the formation of boron-containing intermediates and as a reagent in cross-coupling reactions. The compound's structure indicates a degree of steric hindrance due to the bulky tetramethyl groups, which may influence its reactivity and solubility in various solvents. Additionally, the cyclohexadiene component may impart interesting electronic properties, making it a candidate for studies in materials science or organic electronics. Its stability and reactivity can be affected by environmental factors such as temperature and moisture, which are important considerations for handling and storage. Overall, this compound exemplifies the diverse chemistry of boron compounds and their utility in synthetic organic chemistry.
Formula:C14H23BO2
InChI:InChI=1/C14H23BO2/c1-12(2)9-7-11(8-10-12)15-16-13(3,4)14(5,6)17-15/h7-9H,10H2,1-6H3
SMILES:CC1(C)C=CC(=CC1)B1OC(C)(C)C(C)(C)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.