CAS 87134-87-0
:(5R)-8-Chloro-2,3,4,5-tetrahydro-3-methyl-5-phenyl-1H-3-benzazepin-7-ol (2Z)-2-butenedioate (1:1)
Description:
(5R)-8-Chloro-2,3,4,5-tetrahydro-3-methyl-5-phenyl-1H-3-benzazepin-7-ol (2Z)-2-butenedioate (1:1), with CAS number 87134-87-0, is a complex organic compound characterized by its unique structural features, including a benzazepine core and a butenedioate moiety. This compound exhibits chirality, indicated by the (5R) configuration, which can influence its biological activity and interactions. The presence of a chlorine atom and various functional groups, such as hydroxyl and methyl groups, contributes to its chemical reactivity and potential pharmacological properties. The tetrahydro structure suggests it may exist in a cyclic form, which can affect its stability and solubility in different solvents. Additionally, the compound's molecular interactions may be significant in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and spectral properties, would typically be determined through experimental methods and could provide insights into its applications in research and industry.
Formula:C17H18ClNO·C4H4O4
InChI:InChI=1/C17H18ClNO.C4H4O4/c1-19-8-7-13-9-16(18)17(20)10-14(13)15(11-19)12-5-3-2-4-6-12;5-3(6)1-2-4(7)8/h2-6,9-10,15,20H,7-8,11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t15-;/m1./s1
SMILES:OC=1C=C2[C@H](CN(C)CCC2=CC1Cl)C3=CC=CC=C3.C(=C\C(O)=O)\C(O)=O
Synonyms:- (5R)-8-Chloro-2,3,4,5-tetrahydro-3-methyl-5-phenyl-1H-3-benzazepin-7-ol (2Z)-2-butenedioate (1:1)
- (5R)-8-chloro-3-methyl-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-ol (2Z)-but-2-enedioate (salt)
- 1H-3-Benzazepin-7-ol, 8-chloro-2,3,4,5-tetrahydro-3-methyl-5-phenyl-, (5R)-, (2Z)-2-butenedioate (1:1)
- 1H-3-Benzazepin-7-ol, 8-chloro-2,3,4,5-tetrahydro-3-methyl-5-phenyl-, (5R)-, (2Z)-2-butenedioate (1:1) (salt)
- 1H-3-Benzazepin-7-ol, 8-chloro-2,3,4,5-tetrahydro-3-methyl-5-phenyl-, (R)-, (Z)-2-butenedioate (1:1) (salt)
- Sch 23390 maleate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Sch-23390 maleate
CAS:<p>Sch-23390 is a dopamine receptor agonist that binds to the D2 class of dopamine receptors. It is used in animal studies to study the function of dopamine in neurotransmission, locomotor activity, and memory. Sch-23390 also has been shown to increase the production of catecholamines by stimulating the enzyme hydroxylase, which catalyzes the conversion of tyrosine into dopa, and subsequently into dopamine. This drug has been shown to antagonize voltage-dependent calcium channels and can cause a decrease in chloride ion permeability. Sch-23390 maleate is a non-selective antagonist with no significant affinity for other neurotransmitter receptors.</p>Formula:C21H22ClNO5Purity:Min. 95%Molecular weight:403.9 g/molSCH-23390 maleate
CAS:SCH-23390 maleate (R-(+)-SCH-23390 maleate) is a potent and selective antagonist of dopamine D1-like receptor (1 and D5 receptor with Kis of 0.2 nM and 0.3 nM,Formula:C21H22ClNO5Purity:98%Color and Shape:SolidMolecular weight:403.86

