CAS 87135-01-1
:1,6-Bis(trimethoxysilyl)hexane
Description:
1,6-Bis(trimethoxysilyl)hexane is an organosilicon compound characterized by its two trimethoxysilyl groups attached to a hexane backbone. This structure imparts unique properties, making it useful in various applications, particularly in the field of materials science and surface modification. The presence of methoxy groups allows for hydrolysis and subsequent condensation reactions, facilitating the formation of siloxane networks when exposed to moisture. This compound is typically a colorless to pale yellow liquid, exhibiting low volatility and good thermal stability. It is soluble in organic solvents and can be used as a coupling agent or a silane modifier to enhance adhesion between organic and inorganic materials. Additionally, its ability to form silane bonds makes it valuable in the production of coatings, adhesives, and composites, where improved mechanical properties and resistance to environmental factors are desired. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin and eyes, and proper ventilation is recommended during use.
Formula:C12H30O6Si2
InChI:InChI=1S/C12H30O6Si2/c1-13-19(14-2,15-3)11-9-7-8-10-12-20(16-4,17-5)18-6/h7-12H2,1-6H3
InChI key:InChIKey=GFKCWAROGHMSTC-UHFFFAOYSA-N
SMILES:[Si](CCCCCC[Si](OC)(OC)OC)(OC)(OC)OC
Synonyms:- 1,6-Bis(trimethoxysilyl)hexane
- 2,11-Dioxa-3,10-disiladodecane, 3,3,10,10-tetramethoxy-
- 3,3,10,10-Tetramethoxy-2,11-Dioxa-3,10-Disiladodecane
- B 2495.7
- Bistrimethoxysilylhexane
- Kbe 6830
- Kbm 3066
- Sib 1832.7
- Z 6830
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,6-Bis(trimethoxysilyl)hexane
CAS:Formula:C12H30O6Si2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:326.541,6-Bis(trimethoxysilyl)hexane
CAS:Formula:C12H30O6Si2Purity:95%Color and Shape:LiquidMolecular weight:326.53403,3,10,10-Tetramethoxy-2,11-Dioxa-3,10-Disiladodecane
CAS:3,3,10,10-Tetramethoxy-2,11-Dioxa-3,10-DisiladodecanePurity:95%Molecular weight:326.53g/mol1,6-Bis(trimethoxysilyl)hexane
CAS:<p>S02250 - 1,6-Bis(trimethoxysilyl)hexane</p>Formula:C12H30O6Si2Purity:95%Color and Shape:Liquid, ClearMolecular weight:326.5361,6-Bis(trimethoxysilyl)hexane
CAS:<p>1,6-Bis(trimethoxysilyl)hexane (BTMS) is a silicon-containing compound that can be used to create coatings or as a potential building block in organic electronics. It is stable in acidic conditions and has been shown to react with styrene and water surfaces. BTMS is also reactive when exposed to supercritical carbon dioxide or nonpolar solvents. The chemical structure of BTMS consists of a siloxane backbone and trimethoxysilane groups at each end. This chemical structure allows for the molecule to be gelled under certain conditions, which may make it useful for coating applications.</p>Formula:C12H30O6Si2Purity:Min. 95%Molecular weight:326.54 g/mol





