CymitQuimica logo

CAS 871366-37-9

:

N-[[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylene]-2-propen-1-amine

Description:
N-[[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylene]-2-propen-1-amine, with CAS number 871366-37-9, is an organic compound characterized by its unique structure that includes a boron-containing dioxaborolane moiety. This compound features a phenyl group substituted with a methylene bridge connecting to an allylic amine, which contributes to its reactivity and potential applications in organic synthesis and materials science. The presence of the boron atom in the dioxaborolane structure suggests potential utility in cross-coupling reactions, making it relevant in the field of medicinal chemistry and polymer science. Additionally, the tetramethyl groups enhance its stability and solubility in organic solvents. The compound's reactivity can be influenced by the electron-donating and electron-withdrawing characteristics of its substituents, making it a candidate for further functionalization. Overall, this compound exemplifies the intersection of boron chemistry and organic synthesis, with implications for developing new materials and pharmaceuticals.
Formula:C16H22BNO2
InChI:InChI=1S/C16H22BNO2/c1-6-11-18-12-13-7-9-14(10-8-13)17-19-15(2,3)16(4,5)20-17/h6-10,12H,1,11H2,2-5H3
InChI key:InChIKey=FGDAQAILWBADMY-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(C=NCC=C)C=C2
Synonyms:
  • N-[[4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylene]-2-propen-1-amine
  • 2-Propen-1-amine, N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylene]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.