CAS 871367-14-5

7-bromo-1,3-benzoxazol-2(3H)-one

Description:

7-Bromo-1,3-benzoxazol-2(3H)-one is a heterocyclic organic compound characterized by its fused benzene and oxazole rings, with a bromine substituent at the 7-position. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but may have limited solubility in water. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The oxazole ring contributes to its potential biological activity, as compounds containing oxazole moieties are often investigated for their pharmacological properties. Additionally, 7-bromo-1,3-benzoxazol-2(3H)-one may serve as a building block in the synthesis of more complex molecules in medicinal chemistry and materials science. Its specific applications and reactivity can vary based on the functional groups present and the conditions under which it is used.

Formula: C₇H₄BrNO₂

InChI: InChI=1/C7H4BrNO2/c8-4-2-1-3-5-6(4)11-7(10)9-5/h1-3H,(H,9,10)

SMILES: c1cc(c2c(c1)nc(O)o2)Br

Synonyms:

• 2(3H)-Benzoxazolone, 7-bromo-
• 7-Bromo-1,3-benzoxazol-2(3H)-one

7-Bromobenzo[d]oxazol-2(3H)-one

CAS: 871367-14-5

Formula: C₇H₄BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 214.0162

Ref: IN-DA0036D5

7-Bromobenzo[d]oxazol-2(3H)-one

CAS: 871367-14-5

7-Bromobenzo[d]oxazol-2(3H)-one

Purity: 97%

Molecular weight: 214.018g/mol

Ref: 54-OR73301

7-Bromobenzo[d]oxazol-2(3H)-one

CAS: 871367-14-5

Formula: C₇H₄BrNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 214.018

Ref: 10-F214791