CAS 87141-66-0

1-cyclopropyl-3-(4-methoxyphenyl)propan-1-one

Description:

1-Cyclopropyl-3-(4-methoxyphenyl)propan-1-one, with the CAS number 87141-66-0, is an organic compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring, contributing to its strain and reactivity. The compound also features a propanone functional group, indicating the presence of a carbonyl (C=O) group, which is typical of ketones. The para-methoxyphenyl substituent enhances its aromatic character and may influence its electronic properties and reactivity. This compound is often studied in the context of organic synthesis and medicinal chemistry due to its potential biological activities. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Additionally, the presence of the methoxy group can affect the compound's polarity and interaction with other molecules, making it of interest in various chemical applications, including drug development and material science.

Formula: C₁₃H₁₆O₂

InChI: InChI=1/C13H16O2/c1-15-12-7-2-10(3-8-12)4-9-13(14)11-5-6-11/h2-3,7-8,11H,4-6,9H2,1H3

SMILES: COc1ccc(cc1)CCC(=O)C1CC1