CAS 871478-83-0

1-[(2-Cyanophenyl)sulfonyl]-4-piperidinecarboxylic acid

Description:

1-[(2-Cyanophenyl)sulfonyl]-4-piperidinecarboxylic acid, identified by its CAS number 871478-83-0, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a carboxylic acid functional group that contributes to its acidity and potential reactivity. The presence of a sulfonyl group attached to a cyanophenyl moiety enhances its chemical properties, making it a candidate for various applications in medicinal chemistry and drug development. This compound may exhibit biological activity due to its ability to interact with specific biological targets, potentially influencing pathways related to pain, inflammation, or other physiological processes. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical entities. As with many compounds in pharmaceutical research, understanding its structure-activity relationship is crucial for optimizing its efficacy and safety in potential therapeutic applications.

Formula: C₁₃H₁₄N₂O₄S

InChI: InChI=1S/C13H14N2O4S/c14-9-11-3-1-2-4-12(11)20(18,19)15-7-5-10(6-8-15)13(16)17/h1-4,10H,5-8H2,(H,16,17)

InChI key: InChIKey=LCXDLOJRFZNQRZ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(C#N)C=CC=C1)N2CCC(C(O)=O)CC2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[(2-cyanophenyl)sulfonyl]-
• 1-[(2-Cyanophenyl)sulfonyl]-4-piperidinecarboxylic acid

1-(2-Cyanobenzenesulfonyl)piperidine-4-carboxylic acid

CAS: 871478-83-0

Versatile small molecule scaffold

Formula: C₁₃H₁₄N₂O₄S

Purity: Min. 95%

Molecular weight: 294.33 g/mol

Ref: 3D-WJB47883