
CAS 871497-66-4
:5-[[5-(3-Thienyl)-2H-tetrazol-2-yl]methyl]-1,3,4-oxadiazole-2(3H)-thione
Description:
5-[[5-(3-Thienyl)-2H-tetrazol-2-yl]methyl]-1,3,4-oxadiazole-2(3H)-thione is a heterocyclic compound characterized by its complex structure, which includes a thiazole ring, a tetrazole moiety, and an oxadiazole unit. This compound features a thienyl group, which contributes to its aromatic properties and potential electronic interactions. The presence of the oxadiazole and tetrazole rings suggests that it may exhibit interesting biological activities, possibly as a result of its ability to interact with various biological targets. The thione functional group indicates that the compound may participate in thiol-related chemistry, potentially influencing its reactivity and stability. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of substituents. Overall, this compound may be of interest in medicinal chemistry and materials science due to its unique structural features and potential applications.
Formula:C8H6N6OS2
InChI:InChI=1S/C8H6N6OS2/c16-8-11-9-6(15-8)3-14-12-7(10-13-14)5-1-2-17-4-5/h1-2,4H,3H2,(H,11,16)
InChI key:InChIKey=VMUWZHVIXKFPMG-UHFFFAOYSA-N
SMILES:C(N1N=C(N=N1)C=2C=CSC2)C3=NNC(=S)O3
Synonyms:- 1,3,4-Oxadiazole-2(3H)-thione, 5-[[5-(3-thienyl)-2H-tetrazol-2-yl]methyl]-
- 5-[[5-(3-Thienyl)-2H-tetrazol-2-yl]methyl]-1,3,4-oxadiazole-2(3H)-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.