CAS 871497-70-0

5-(4-Methylphenyl)-1,3,4-oxadiazole-2-propanoic acid

Description:

5-(4-Methylphenyl)-1,3,4-oxadiazole-2-propanoic acid is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a propanoic acid functional group, contributing to its acidic properties. The presence of the 4-methylphenyl group enhances its hydrophobic characteristics, potentially influencing its solubility and interaction with biological systems. The oxadiazole moiety is known for its applications in pharmaceuticals and materials science, often exhibiting interesting electronic and photophysical properties. This compound may also possess biological activity, making it of interest in medicinal chemistry. Its CAS number, 871497-70-0, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications. Overall, the unique structural features of this compound suggest it may have diverse applications in various fields, including drug development and organic synthesis.

Formula: C₁₂H₁₂N₂O₃

InChI: InChI=1S/C12H12N2O3/c1-8-2-4-9(5-3-8)12-14-13-10(17-12)6-7-11(15)16/h2-5H,6-7H2,1H3,(H,15,16)

InChI key: InChIKey=IUZLHKJZIFDECJ-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C=1OC(=NN1)C2=CC=C(C)C=C2

Synonyms:

• 5-(4-Methylphenyl)-1,3,4-oxadiazole-2-propanoic acid
• 1,3,4-Oxadiazole-2-propanoic acid, 5-(4-methylphenyl)-

3-[5-(4-Methylphenyl)-1,3,4-oxadiazol-2-yl]propanoic acid

CAS: 871497-70-0

Versatile small molecule scaffold

Formula: C₁₂H₁₂N₂O₃

Purity: Min. 95%

Molecular weight: 232.23 g/mol

Ref: 3D-WJB49770