CymitQuimica logo

CAS 871497-73-3

:

2-Chloro-N-(1-cyanocyclohexyl)-N-methylpropanamide

Description:
2-Chloro-N-(1-cyanocyclohexyl)-N-methylpropanamide is a chemical compound characterized by its unique structure, which includes a chloro group, a cyanocyclohexyl moiety, and a propanamide backbone. This compound features a chlorine atom attached to the second carbon of the propanamide, which can influence its reactivity and solubility. The presence of the cyanocyclohexyl group contributes to its potential biological activity, as this moiety can interact with various biological targets. The amide functional group is known for its ability to form hydrogen bonds, which can affect the compound's physical properties, such as melting and boiling points, as well as its solubility in polar and non-polar solvents. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 871497-73-3, allows for precise identification and retrieval of information related to its synthesis, applications, and safety data in chemical databases.
Formula:C11H17ClN2O
InChI:InChI=1S/C11H17ClN2O/c1-9(12)10(15)14(2)11(8-13)6-4-3-5-7-11/h9H,3-7H2,1-2H3
InChI key:InChIKey=FYJXCYSNCDIYAS-UHFFFAOYSA-N
SMILES:N(C(C(C)Cl)=O)(C)C1(C#N)CCCCC1
Synonyms:
  • Propanamide, 2-chloro-N-(1-cyanocyclohexyl)-N-methyl-
  • 2-Chloro-N-(1-cyanocyclohexyl)-N-methylpropanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.