
CAS 871507-60-7
:2-Cyclopropyl-1-methyl-1H-imidazole
Description:
2-Cyclopropyl-1-methyl-1H-imidazole is a chemical compound characterized by its unique bicyclic structure, which includes a five-membered imidazole ring fused with a cyclopropyl group. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for drug development due to its ability to interact with various biological targets. The presence of both the cyclopropyl and imidazole moieties contributes to its chemical reactivity and solubility in organic solvents. Additionally, 2-Cyclopropyl-1-methyl-1H-imidazole may exhibit moderate stability under standard conditions but should be handled with care due to potential reactivity with strong oxidizing agents. Its specific applications and safety profile would depend on further research and characterization in the context of its intended use.
Formula:C7H10N2
InChI:InChI=1S/C7H10N2/c1-9-5-4-8-7(9)6-2-3-6/h4-6H,2-3H2,1H3
InChI key:InChIKey=CVWGFCNSHOZVQS-UHFFFAOYSA-N
SMILES:CN1C(=NC=C1)C2CC2
Synonyms:- 1H-Imidazole, 2-cyclopropyl-1-methyl-
- 2-Cyclopropyl-1-methyl-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.