CAS 87152-97-4

6-[4-[1-(4-benzyloxycyclohexyl)tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one

Description:

The chemical substance known as 6-[4-[1-(4-benzyloxycyclohexyl)tetrazol-5-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one, with the CAS number 87152-97-4, is a complex organic compound characterized by its unique structural features. It contains a quinolinone core, which is a bicyclic structure known for its biological activity, particularly in medicinal chemistry. The presence of a tetrazole ring contributes to its potential pharmacological properties, as tetrazoles are often associated with various biological activities, including anti-inflammatory and antimicrobial effects. The compound also features a benzyloxy group and a cyclohexyl moiety, which may influence its lipophilicity and ability to cross biological membranes. Its synthesis and characterization typically involve advanced organic chemistry techniques, and it may be of interest in drug development due to its potential interactions with biological targets. Overall, this compound exemplifies the complexity and diversity of organic molecules used in pharmaceutical research.

Formula: C₂₇H₃₃N₅O₃

InChI: InChI=1/C27H33N5O3/c33-27-16-9-21-18-24(14-15-25(21)28-27)34-17-5-4-8-26-29-30-31-32(26)22-10-12-23(13-11-22)35-19-20-6-2-1-3-7-20/h1-3,6-7,14-15,18,22-23H,4-5,8-13,16-17,19H2,(H,28,33)/t22?,23-

SMILES: c1ccc(cc1)CO[C@H]1CCC(CC1)n1c(CCCCOc2ccc3c(CCC(=O)N3)c2)nnn1

trans-3,4-Dihydro-6-[4-[1-[4-(phenylmethoxy)cyclohexyl]-1H-tetrazol-5-yl]butoxy]-2(1H)-quinolinone

Controlled Product

CAS: 87152-97-4

Applications 2-Oxoquinoline derivative as blood platelet aggregation inhibitors. Intermediate of OPC-13013, a metabolite of Cilostazol.
References Nishi, T., et al.: Chem. Pharm. Bull., 33, 1140 (1985),

Formula: C₂₇H₃₃N₅O₃

Color and Shape: Neat

Molecular weight: 475.58

Ref: TR-D449250