CAS 871544-57-9
:N'-hydroxy-2-(2-oxopyridin-1(2H)-yl)ethanimidamide
Description:
N'-hydroxy-2-(2-oxopyridin-1(2H)-yl)ethanimidamide, with the CAS number 871544-57-9, is a chemical compound characterized by its unique structural features, which include a hydroxylamine functional group and a pyridine derivative. This compound typically exhibits properties associated with both amides and hydroxylamines, such as potential reactivity in nucleophilic substitution reactions and the ability to form hydrogen bonds due to the presence of the hydroxyl group. It may also display biological activity, potentially acting as an enzyme inhibitor or a ligand in coordination chemistry, owing to the presence of the pyridine ring. The compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions, making it of interest in various fields, including medicinal chemistry and materials science. Its specific applications and interactions would depend on further experimental studies and characterization.
Formula:C7H9N3O2
InChI:InChI=1/C7H9N3O2/c8-6(9-12)5-10-4-2-1-3-7(10)11/h1-4,12H,5H2,(H2,8,9)
SMILES:c1ccn(CC(=N)NO)c(=O)c1
Synonyms:- (1E)-N'-Hydroxy-2-(2-oxopyridin-1(2H)-yl)ethanimidamide
- 1(2H)-pyridineethanimidamide, N'-hydroxy-2-oxo-
- N-hydroxy-2-oxo-1(2H)-Pyridineethanimidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
