CAS 871544-58-0
:4-(1-Pyrrolidinylsulfonyl)benzenepropanoic acid
Description:
4-(1-Pyrrolidinylsulfonyl)benzenepropanoic acid, identified by its CAS number 871544-58-0, is a chemical compound characterized by its unique structure that includes a benzene ring substituted with a pyrrolidinylsulfonyl group and a propanoic acid moiety. This compound typically exhibits properties associated with both sulfonamides and carboxylic acids, which may influence its solubility and reactivity. It is likely to be a solid at room temperature and may have moderate to high solubility in polar solvents due to the presence of the carboxylic acid functional group. The pyrrolidinyl group can contribute to its biological activity, potentially making it relevant in pharmaceutical applications. The sulfonyl group may enhance its interaction with biological targets, influencing its pharmacokinetic properties. Overall, this compound's characteristics suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents. However, specific applications and biological activities would require further investigation through empirical studies.
Formula:C13H17NO4S
InChI:InChI=1S/C13H17NO4S/c15-13(16)8-5-11-3-6-12(7-4-11)19(17,18)14-9-1-2-10-14/h3-4,6-7H,1-2,5,8-10H2,(H,15,16)
InChI key:InChIKey=MTQWYBPEKXZYQW-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(CCC(O)=O)C=C1)N2CCCC2
Synonyms:- 4-(1-Pyrrolidinylsulfonyl)benzenepropanoic acid
- Benzenepropanoic Acid, 4-(1-Pyrrolidinylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
