CymitQuimica logo

CAS 871550-15-1

:

Fluconazole Related Compound A

Description:
Fluconazole Related Compound A, with the CAS number 871550-15-1, is a chemical compound that is structurally related to fluconazole, an antifungal medication. This compound is primarily characterized by its role in pharmaceutical research and development, particularly in the context of assessing the purity and stability of fluconazole formulations. It may exhibit similar antifungal properties, but its specific biological activity and efficacy can vary. The compound is typically analyzed using techniques such as high-performance liquid chromatography (HPLC) to ensure quality control in drug manufacturing. Its molecular structure includes functional groups that are common in azole antifungals, which contribute to its mechanism of action by inhibiting fungal sterol synthesis. As a related compound, it serves as a reference standard in analytical chemistry, helping to identify and quantify fluconazole and its metabolites in biological samples. Safety data and handling precautions are essential, as with any chemical substance, to mitigate potential hazards during laboratory use.
Formula:C15H14FN9O
InChI:InChI=1S/C15H14FN9O/c16-14-3-12(25-11-19-8-22-25)1-2-13(14)15(26,4-23-9-17-6-20-23)5-24-10-18-7-21-24/h1-3,6-11,26H,4-5H2
InChI key:MMBHIHSCHXTGOX-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1N2C=NC=N2)F)C(CN3C=NC=N3)(CN4C=NC=N4)O
Synonyms:
  • 2-[2-Fluoro-4-(1H-1,2,4-triazol-1-yl)phenyl]-1,3-bis(1H-1,2,4-triazol-1-yl)propan-2-ol
  • alpha-[2-Fluoro-4-(1H-1,2,4-triazol-1-yl)phenyl]-alpha-(1H-1,2,4-triazol-1-ylmethyl)-1H-1,2,4-triazole-1-ethanol
Found 8 products.