CAS 871583-15-2

methyl 4-bromo-1H-pyrrolo[3,2-c]pyridine-2-carboxylate

Description:

Methyl 4-bromo-1H-pyrrolo[3,2-c]pyridine-2-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a bromine atom and a carboxylate functional group. This compound typically exhibits a molecular formula that reflects its complex structure, featuring a pyridine ring fused to a pyrrole ring. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. The methyl ester group contributes to its solubility in organic solvents and can participate in esterification reactions. Methyl 4-bromo-1H-pyrrolo[3,2-c]pyridine-2-carboxylate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features can influence its physical properties, such as melting point and boiling point, as well as its reactivity and interaction with biological targets. Overall, this compound represents a valuable scaffold for further research and potential applications in pharmaceuticals and agrochemicals.

Formula: C₉H₇BrN₂O₂

InChI: InChI=1/C9H7BrN2O2/c1-14-9(13)7-4-5-6(12-7)2-3-11-8(5)10/h2-4,12H,1H3

SMILES: COC(=O)c1cc2c(ccnc2Br)[nH]1

Synonyms:

• Methyl 4-bromo-1H-pyrrolo[3,2-c]pyridine-2-carboxylate

methyl 4-bromo-1H-pyrrolo[3,2-c]pyridine-2-carboxylate

CAS: 871583-15-2

Formula: C₉H₇BrN₂O₂

Purity: 97%

Molecular weight: 255.0681

Ref: IN-DA003RUT

Methyl 4-bromo-1H-pyrrolo[3,2-c]pyridine-2-carboxylate

CAS: 871583-15-2

Methyl 4-bromo-1H-pyrrolo[3,2-c]pyridine-2-carboxylate is a chemical intermediate that is used in the production of plastics. It has heat resistance, a low melting point and good lubricating properties. The product can be used for making polymers such as acrylic resins, hydrogenated plastics and lubricants. Methyl 4-bromo-1H-pyrrolo[3,2-c]pyridine-2-carboxylate is also used as an additive in various products such as adhesives, sealants, paints and coatings.

Formula: C₉H₇BrN₂O₂

Purity: Min. 95%

Molecular weight: 255.07 g/mol

Ref: 3D-WJB58315