CymitQuimica logo

CAS 871587-68-7

:

3-(3-Fluorophenoxy)pyrrolidine

Description:
3-(3-Fluorophenoxy)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a 3-fluorophenoxy group. The presence of the fluorine atom in the phenoxy group can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. This compound is typically classified as an organic heterocyclic compound due to the nitrogen atom in the pyrrolidine ring. It may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. The molecular interactions of 3-(3-Fluorophenoxy)pyrrolidine can be influenced by its stereochemistry and functional groups, which may affect its solubility, stability, and reactivity. Additionally, the compound's potential applications could span various fields, including pharmaceuticals and agrochemicals, depending on its specific biological activity and mechanism of action. As with many chemical substances, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C10H12FNO
InChI:InChI=1S/C10H12FNO/c11-8-2-1-3-9(6-8)13-10-4-5-12-7-10/h1-3,6,10,12H,4-5,7H2
InChI key:InChIKey=AKHGRTYTFZRUHJ-UHFFFAOYSA-N
SMILES:O(C1=CC(F)=CC=C1)C2CCNC2
Synonyms:
  • 3-(3-Fluorophenoxy)pyrrolidine
  • Pyrrolidine, 3-(3-fluorophenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.