CAS 87164-90-7
:6-[(E)-2-pyridin-4-ylethenyl]-4,5-dihydropyridazin-3(2H)-one
Description:
6-[(E)-2-pyridin-4-ylethenyl]-4,5-dihydropyridazin-3(2H)-one, with the CAS number 87164-90-7, is a chemical compound characterized by its unique structure that includes a pyridazine ring fused with a pyridine moiety. This compound features a double bond between the pyridine and the ethenyl group, indicating its potential for reactivity and interaction with other chemical species. It is typically classified as an organic heterocyclic compound due to the presence of nitrogen atoms in its ring structure. The compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the presence of functional groups in its structure may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Overall, this compound represents a class of substances that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C11H11N3O
InChI:InChI=1/C11H11N3O/c15-11-4-3-10(13-14-11)2-1-9-5-7-12-8-6-9/h1-2,5-8H,3-4H2,(H,14,15)/b2-1+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(E)-4,5-Dihydro-6-(2-(4-pyridinyl)ethenyl)-3(2H)-pyridazinone
CAS:(E)-4,5-Dihydro-6-(2-(4-pyridinyl)ethenyl)-3(2H)-pyridazinone is a neurohormonal that is used to treat systemic hypertension. It binds to the enzymes in the sympathetic nervous system and blocks the production of norepinephrine and epinephrine. This results in decreased blood pressure by reducing peripheral vascular resistance, slowing heart rate, and reducing cardiac output. (E)-4,5-Dihydro-6-(2-(4-pyridinyl)ethenyl)-3(2H)-pyridazinone is also known as a vasodilator due to its ability to relax vascular smooth muscle cells. The drug has been demonstrated effective at lowering blood pressure in animals with congestive heart failure.Formula:C11H11N3OPurity:Min. 95%Molecular weight:201.22 g/molICI 153110
CAS:ICI 153110: Oral phosphodiesterase inhibitor for treating congestive heart failure, has inotropic, vasodilator effects.Formula:C11H11N3OPurity:98%Color and Shape:SolidMolecular weight:201.22

