CAS 871673-28-8

2,4-Dimethyl 3-(bromomethyl)-5-[(2-thienylcarbonyl)amino]-2,4-thiophenedicarboxylate

Description:

2,4-Dimethyl 3-(bromomethyl)-5-[(2-thienylcarbonyl)amino]-2,4-thiophenedicarboxylate is a complex organic compound characterized by its multi-functional groups and heterocyclic structure. This compound features a thiophene backbone, which contributes to its aromatic properties and potential reactivity. The presence of bromomethyl and thienylcarbonyl groups indicates that it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The dimethyl groups enhance its lipophilicity, potentially influencing its solubility and biological activity. Additionally, the carboxylate moieties suggest that it may exhibit acidic properties, which could be relevant in various chemical contexts. Given its structural complexity, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its unique combination of functional groups may also allow for specific interactions with biological targets, making it a candidate for further research in drug design or material science. Overall, the compound's characteristics suggest a versatile chemical with potential utility in various fields.

Formula: C₁₄H₁₂BrNO₅S₂

InChI: InChI=1S/C14H12BrNO5S2/c1-20-13(18)9-7(6-15)10(14(19)21-2)23-12(9)16-11(17)8-4-3-5-22-8/h3-5H,6H2,1-2H3,(H,16,17)

InChI key: InChIKey=SITGSHBAORNBFP-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(CBr)=C(C(OC)=O)SC1NC(=O)C2=CC=CS2

Synonyms:

• 2,4-Thiophenedicarboxylic acid, 3-(bromomethyl)-5-[(2-thienylcarbonyl)amino]-, dimethyl ester
• 2,4-Thiophenedicarboxylic acid, 3-(bromomethyl)-5-[(2-thienylcarbonyl)amino]-, 2,4-dimethyl ester
• 2,4-Dimethyl 3-(bromomethyl)-5-[(2-thienylcarbonyl)amino]-2,4-thiophenedicarboxylate